C23H34N6O9 — CID 175747976
(4S)-5-[[(1S,2R)-1-carboxy-2-hydroxypropyl]amino]-4-[[(2S)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-5-oxopentanoic acid (PubChem CID 175747976) has the molecular formula C23H34N6O9 and a molecular weight of 538.56 g/mol. Its IUPAC name is (4S)-5-[[(1S,2R)-1-carboxy-2-hydroxypropyl]amino]-4-[[(2S)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-[[(1S,2R)-1-carboxy-2-hydroxypropyl]amino]-4-[[(2S)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 175747976 |
| Molecular Formula | C23H34N6O9 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.24 |
| IUPAC Name | (4S)-5-[[(1S,2R)-1-carboxy-2-hydroxypropyl]amino]-4-[[(2S)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-5-oxopentanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCN=C(N)N)NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H34N6O9/c1-13(30)18(21(35)36)29-20(34)16(9-10-17(31)32)27-19(33)15(8-5-11-26-22(24)25)28-23(37)38-12-14-6-3-2-4-7-14/h2-4,6-7,13,15-16,18,30H,5,8-12H2,1H3,(H,27,33)(H,28,37)(H,29,34)(H,31,32)(H,35,36)(H4,24,25,26)/t13-,15+,16+,18+/m1/s1 |
| InChIKey | UFLSAYGLQCMHFD-VKZRIFJHSA-N |
| XLogP | -1.37 |
| TPSA | 255.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|