C22H26N4O5 — CID 57077082
benzyl (3S)-6-(diaminomethylideneamino)-2-oxo-3-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 57077082) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is benzyl (3S)-6-(diaminomethylideneamino)-2-oxo-3-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | benzyl (3S)-6-(diaminomethylideneamino)-2-oxo-3-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 57077082 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | benzyl (3S)-6-(diaminomethylideneamino)-2-oxo-3-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | NC(N)=NCCC[C@H](NC(=O)OCc1ccccc1)C(=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H26N4O5/c23-21(24)25-13-7-12-18(26-22(29)31-15-17-10-5-2-6-11-17)19(27)20(28)30-14-16-8-3-1-4-9-16/h1-6,8-11,18H,7,12-15H2,(H,26,29)(H4,23,24,25)/t18-/m0/s1 |
| InChIKey | HDVIGUMSOZXIHW-SFHVURJKSA-N |
| XLogP | 1.65 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|