C20H21N3O6 — CID 15229480
3-[bis(phenylmethoxycarbonylamino)methylideneamino]propanoic acid (PubChem CID 15229480) has the molecular formula C20H21N3O6 and a molecular weight of 399.40 g/mol. Its IUPAC name is 3-[bis(phenylmethoxycarbonylamino)methylideneamino]propanoic acid.
| Compound Name | 3-[bis(phenylmethoxycarbonylamino)methylideneamino]propanoic acid |
|---|---|
| PubChem CID | 15229480 |
| Molecular Formula | C20H21N3O6 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 3-[bis(phenylmethoxycarbonylamino)methylideneamino]propanoic acid |
| SMILES | O=C(O)CCN=C(NC(=O)OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H21N3O6/c24-17(25)11-12-21-18(22-19(26)28-13-15-7-3-1-4-8-15)23-20(27)29-14-16-9-5-2-6-10-16/h1-10H,11-14H2,(H,24,25)(H2,21,22,23,26,27) |
| InChIKey | CZAASJNTNDEGJX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|