C26H25N3O6 — CID 15342318
(2S)-2-[bis(phenylmethoxycarbonylamino)methylideneamino]-3-phenylpropanoic acid (PubChem CID 15342318) has the molecular formula C26H25N3O6 and a molecular weight of 475.50 g/mol. Its IUPAC name is (2S)-2-[bis(phenylmethoxycarbonylamino)methylideneamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[bis(phenylmethoxycarbonylamino)methylideneamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 15342318 |
| Molecular Formula | C26H25N3O6 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | (2S)-2-[bis(phenylmethoxycarbonylamino)methylideneamino]-3-phenylpropanoic acid |
| SMILES | O=C(NC(=N[C@@H](Cc1ccccc1)C(=O)O)NC(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C26H25N3O6/c30-23(31)22(16-19-10-4-1-5-11-19)27-24(28-25(32)34-17-20-12-6-2-7-13-20)29-26(33)35-18-21-14-8-3-9-15-21/h1-15,22H,16-18H2,(H,30,31)(H2,27,28,29,32,33)/t22-/m0/s1 |
| InChIKey | LTDZZZCRGVMDMO-QFIPXVFZSA-N |
| XLogP | 3.89 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|