About benzyl N-carbamothioylcarbamate
benzyl N-carbamothioylcarbamate (PubChem CID 23366039) has the molecular formula C9H10N2O2S
and a molecular weight of 210.26 g/mol. Its IUPAC name is benzyl N-carbamothioylcarbamate.
Molecular Properties
| Compound Name | benzyl N-carbamothioylcarbamate |
| PubChem CID | 23366039 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | benzyl N-carbamothioylcarbamate |
| SMILES | NC(=S)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C9H10N2O2S/c10-8(14)11-9(12)13-6-7-4-2-1-3-5-7/h1-5H,6H2,(H3,10,11,12,14) |
| InChIKey | QNBJYIDSJFPLHM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-carbamothioylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-carbamothioylcarbamate?
The IUPAC name of benzyl N-carbamothioylcarbamate (CID 23366039) is benzyl N-carbamothioylcarbamate.
What is the SMILES notation for benzyl N-carbamothioylcarbamate?
The canonical SMILES for benzyl N-carbamothioylcarbamate is NC(=S)NC(=O)OCc1ccccc1.
What is the InChIKey of benzyl N-carbamothioylcarbamate?
The InChIKey is QNBJYIDSJFPLHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2S/c10-8(14)11-9(12)13-6-7-4-2-1-3-5-7/h1-5H,6H2,(H3,10,11,12,14).
What are the key properties of benzyl N-carbamothioylcarbamate?
benzyl N-carbamothioylcarbamate has a molecular weight of 210.26 g/mol, XLogP of 1.16, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-carbamothioylcarbamate is sourced from PubChem (CID 23366039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).