C38H41N5O7 — CID 124587115
benzyl N-[(2S)-5-[bis(phenylmethoxycarbonylamino)methylideneamino]-1-(3,4-dimethylanilino)-1-oxopentan-2-yl]carbamate (PubChem CID 124587115) has the molecular formula C38H41N5O7 and a molecular weight of 679.77 g/mol. Its IUPAC name is benzyl N-[(2S)-5-[bis(phenylmethoxycarbonylamino)methylideneamino]-1-(3,4-dimethylanilino)-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-5-[bis(phenylmethoxycarbonylamino)methylideneamino]-1-(3,4-dimethylanilino)-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 124587115 |
| Molecular Formula | C38H41N5O7 |
| Molecular Weight | 679.77 g/mol |
| Exact Mass | 679.30 |
| IUPAC Name | benzyl N-[(2S)-5-[bis(phenylmethoxycarbonylamino)methylideneamino]-1-(3,4-dimethylanilino)-1-oxopentan-2-yl]carbamate |
| SMILES | Cc1ccc(NC(=O)[C@H](CCCN=C(NC(=O)OCc2ccccc2)NC(=O)OCc2ccccc2)NC(=O)OCc2ccccc2)cc1C |
| InChI | InChI=1S/C38H41N5O7/c1-27-20-21-32(23-28(27)2)40-34(44)33(41-36(45)48-24-29-13-6-3-7-14-29)19-12-22-39-35(42-37(46)49-25-30-15-8-4-9-16-30)43-38(47)50-26-31-17-10-5-11-18-31/h3-11,13-18,20-21,23,33H,12,19,22,24-26H2,1-2H3,(H,40,44)(H,41,45)(H2,39,42,43,46,47)/t33-/m0/s1 |
| InChIKey | VGFWJXGFOBSZKY-XIFFEERXSA-N |
| XLogP | 6.53 |
| TPSA | 156.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.77 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|