C33H36N6O4 — CID 67601662
benzyl N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-1-(naphthalen-2-ylamino)-1-oxo-3-phenylpropan-2-yl]amino]-1-oxopentan-2-yl]carbamate (PubChem CID 67601662) has the molecular formula C33H36N6O4 and a molecular weight of 580.69 g/mol. Its IUPAC name is benzyl N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-1-(naphthalen-2-ylamino)-1-oxo-3-phenylpropan-2-yl]amino]-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-1-(naphthalen-2-ylamino)-1-oxo-3-phenylpropan-2-yl]amino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 67601662 |
| Molecular Formula | C33H36N6O4 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | benzyl N-[(2S)-5-(diaminomethylideneamino)-1-[[(2S)-1-(naphthalen-2-ylamino)-1-oxo-3-phenylpropan-2-yl]amino]-1-oxopentan-2-yl]carbamate |
| SMILES | NC(N)=NCCC[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C33H36N6O4/c34-32(35)36-19-9-16-28(39-33(42)43-22-24-12-5-2-6-13-24)30(40)38-29(20-23-10-3-1-4-11-23)31(41)37-27-18-17-25-14-7-8-15-26(25)21-27/h1-8,10-15,17-18,21,28-29H,9,16,19-20,22H2,(H,37,41)(H,38,40)(H,39,42)(H4,34,35,36)/t28-,29-/m0/s1 |
| InChIKey | WSCLUXMWJKFDSO-VMPREFPWSA-N |
| XLogP | 3.85 |
| TPSA | 160.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|