C44H54N6O10 — CID 20715730
3-methylbutan-2-yl 4-[3-[3-[[(E)-N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]-ethylamino]propyl]-2-oxo-4-phenylmethoxycarbonylazetidine-1-carbonyl]piperazine-1-carboxylate (PubChem CID 20715730) has the molecular formula C44H54N6O10 and a molecular weight of 826.95 g/mol. Its IUPAC name is 3-methylbutan-2-yl 4-[3-[3-[[(E)-N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]-ethylamino]propyl]-2-oxo-4-phenylmethoxycarbonylazetidine-1-carbonyl]piperazine-1-carboxylate.
| Compound Name | 3-methylbutan-2-yl 4-[3-[3-[[(E)-N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]-ethylamino]propyl]-2-oxo-4-phenylmethoxycarbonylazetidine-1-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 20715730 |
| Molecular Formula | C44H54N6O10 |
| Molecular Weight | 826.95 g/mol |
| Exact Mass | 826.39 |
| IUPAC Name | 3-methylbutan-2-yl 4-[3-[3-[[(E)-N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]-ethylamino]propyl]-2-oxo-4-phenylmethoxycarbonylazetidine-1-carbonyl]piperazine-1-carboxylate |
| SMILES | CCN(CCCC1C(=O)N(C(=O)N2CCN(C(=O)OC(C)C(C)C)CC2)C1C(=O)OCc1ccccc1)/C(=N/C(=O)OCc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C44H54N6O10/c1-5-47(40(45-41(53)58-29-34-18-11-7-12-19-34)46-42(54)59-30-35-20-13-8-14-21-35)23-15-22-36-37(39(52)57-28-33-16-9-6-10-17-33)50(38(36)51)43(55)48-24-26-49(27-25-48)44(56)60-32(4)31(2)3/h6-14,16-21,31-32,36-37H,5,15,22-30H2,1-4H3,(H,45,46,53,54) |
| InChIKey | JQVHVMGNMKJCSX-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 176.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.95 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|