C39H44N6O8 — CID 59869886
benzyl (3R)-3-[[1-[(E)-N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]piperidin-3-yl]methyl]-4-oxo-1-(piperazine-1-carbonyl)azetidine-2-carboxylate (PubChem CID 59869886) has the molecular formula C39H44N6O8 and a molecular weight of 724.82 g/mol. Its IUPAC name is benzyl (3R)-3-[[1-[(E)-N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]piperidin-3-yl]methyl]-4-oxo-1-(piperazine-1-carbonyl)azetidine-2-carboxylate.
| Compound Name | benzyl (3R)-3-[[1-[(E)-N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]piperidin-3-yl]methyl]-4-oxo-1-(piperazine-1-carbonyl)azetidine-2-carboxylate |
|---|---|
| PubChem CID | 59869886 |
| Molecular Formula | C39H44N6O8 |
| Molecular Weight | 724.82 g/mol |
| Exact Mass | 724.32 |
| IUPAC Name | benzyl (3R)-3-[[1-[(E)-N,N'-bis(phenylmethoxycarbonyl)carbamimidoyl]piperidin-3-yl]methyl]-4-oxo-1-(piperazine-1-carbonyl)azetidine-2-carboxylate |
| SMILES | O=C(/N=C(\NC(=O)OCc1ccccc1)N1CCCC(C[C@H]2C(=O)N(C(=O)N3CCNCC3)C2C(=O)OCc2ccccc2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C39H44N6O8/c46-34-32(33(35(47)51-25-28-11-4-1-5-12-28)45(34)39(50)43-21-18-40-19-22-43)23-31-17-10-20-44(24-31)36(41-37(48)52-26-29-13-6-2-7-14-29)42-38(49)53-27-30-15-8-3-9-16-30/h1-9,11-16,31-33,40H,10,17-27H2,(H,41,42,48,49)/t31?,32-,33?/m1/s1 |
| InChIKey | UNIBEFKQWFODEB-QYEGGPJFSA-N |
| XLogP | 4.30 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.82 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|