C36H48N6O5 — CID 20715997
benzyl 3-[2-(1-carbamimidoylpiperidin-3-yl)ethyl]-4-oxo-1-[4-(6-phenylhexanoyl)piperazine-1-carbonyl]azetidine-2-carboxylate (PubChem CID 20715997) has the molecular formula C36H48N6O5 and a molecular weight of 644.82 g/mol. Its IUPAC name is benzyl 3-[2-(1-carbamimidoylpiperidin-3-yl)ethyl]-4-oxo-1-[4-(6-phenylhexanoyl)piperazine-1-carbonyl]azetidine-2-carboxylate.
| Compound Name | benzyl 3-[2-(1-carbamimidoylpiperidin-3-yl)ethyl]-4-oxo-1-[4-(6-phenylhexanoyl)piperazine-1-carbonyl]azetidine-2-carboxylate |
|---|---|
| PubChem CID | 20715997 |
| Molecular Formula | C36H48N6O5 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.37 |
| IUPAC Name | benzyl 3-[2-(1-carbamimidoylpiperidin-3-yl)ethyl]-4-oxo-1-[4-(6-phenylhexanoyl)piperazine-1-carbonyl]azetidine-2-carboxylate |
| SMILES | [H]/N=C(\N)N1CCCC(CCC2C(=O)N(C(=O)N3CCN(C(=O)CCCCCc4ccccc4)CC3)C2C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C36H48N6O5/c37-35(38)41-20-10-16-28(25-41)18-19-30-32(34(45)47-26-29-14-7-2-8-15-29)42(33(30)44)36(46)40-23-21-39(22-24-40)31(43)17-9-3-6-13-27-11-4-1-5-12-27/h1-2,4-5,7-8,11-12,14-15,28,30,32H,3,6,9-10,13,16-26H2,(H3,37,38) |
| InChIKey | QIFPQVGMRNNVNP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|