C34H43ClN6O10 — CID 159145922
(3R)-3-[(1-carbamimidoylpiperidin-3-yl)methyl]-4-oxo-1-[4-(2-phenoxyethoxycarbonyl)piperazine-1-carbonyl]azetidine-2-carboxylic acid;2-phenoxyethyl carbonochloridate (PubChem CID 159145922) has the molecular formula C34H43ClN6O10 and a molecular weight of 731.20 g/mol. Its IUPAC name is (3R)-3-[(1-carbamimidoylpiperidin-3-yl)methyl]-4-oxo-1-[4-(2-phenoxyethoxycarbonyl)piperazine-1-carbonyl]azetidine-2-carboxylic acid;2-phenoxyethyl carbonochloridate.
| Compound Name | (3R)-3-[(1-carbamimidoylpiperidin-3-yl)methyl]-4-oxo-1-[4-(2-phenoxyethoxycarbonyl)piperazine-1-carbonyl]azetidine-2-carboxylic acid;2-phenoxyethyl carbonochloridate |
|---|---|
| PubChem CID | 159145922 |
| Molecular Formula | C34H43ClN6O10 |
| Molecular Weight | 731.20 g/mol |
| Exact Mass | 730.27 |
| IUPAC Name | (3R)-3-[(1-carbamimidoylpiperidin-3-yl)methyl]-4-oxo-1-[4-(2-phenoxyethoxycarbonyl)piperazine-1-carbonyl]azetidine-2-carboxylic acid;2-phenoxyethyl carbonochloridate |
| SMILES | O=C(Cl)OCCOc1ccccc1.[H]/N=C(\N)N1CCCC(C[C@H]2C(=O)N(C(=O)N3CCN(C(=O)OCCOc4ccccc4)CC3)C2C(=O)O)C1 |
| InChI | InChI=1S/C25H34N6O7.C9H9ClO3/c26-23(27)30-8-4-5-17(16-30)15-19-20(22(33)34)31(21(19)32)24(35)28-9-11-29(12-10-28)25(36)38-14-13-37-18-6-2-1-3-7-18;10-9(11)13-7-6-12-8-4-2-1-3-5-8/h1-3,6-7,17,19-20H,4-5,8-16H2,(H3,26,27)(H,33,34);1-5H,6-7H2/t17?,19-,20?;/m1./s1 |
| InChIKey | KIRFPVCWFBJISY-JOAAGEPPSA-N |
| XLogP | 3.29 |
| TPSA | 205.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.20 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|