C15H22N4O2 — CID 70047293
benzyl-[[(3S)-1-carbamimidoylpiperidin-3-yl]methyl]carbamic acid (PubChem CID 70047293) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is benzyl-[[(3S)-1-carbamimidoylpiperidin-3-yl]methyl]carbamic acid.
| Compound Name | benzyl-[[(3S)-1-carbamimidoylpiperidin-3-yl]methyl]carbamic acid |
|---|---|
| PubChem CID | 70047293 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | benzyl-[[(3S)-1-carbamimidoylpiperidin-3-yl]methyl]carbamic acid |
| SMILES | [H]/N=C(\N)N1CCC[C@H](CN(Cc2ccccc2)C(=O)O)C1 |
| InChI | InChI=1S/C15H22N4O2/c16-14(17)18-8-4-7-13(10-18)11-19(15(20)21)9-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11H2,(H3,16,17)(H,20,21)/t13-/m0/s1 |
| InChIKey | PLAUCNLLQWEWET-ZDUSSCGKSA-N |
| XLogP | 1.77 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|