C22H25N3O2 — CID 89199444
(3S)-3-[1-(9H-xanthen-9-yl)ethenoxymethyl]piperidine-1-carboximidamide (PubChem CID 89199444) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is (3S)-3-[1-(9H-xanthen-9-yl)ethenoxymethyl]piperidine-1-carboximidamide.
| Compound Name | (3S)-3-[1-(9H-xanthen-9-yl)ethenoxymethyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 89199444 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | (3S)-3-[1-(9H-xanthen-9-yl)ethenoxymethyl]piperidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCC[C@H](COC(=C)C2c3ccccc3Oc3ccccc32)C1 |
| InChI | InChI=1S/C22H25N3O2/c1-15(26-14-16-7-6-12-25(13-16)22(23)24)21-17-8-2-4-10-19(17)27-20-11-5-3-9-18(20)21/h2-5,8-11,16,21H,1,6-7,12-14H2,(H3,23,24)/t16-/m0/s1 |
| InChIKey | LWQANNZZVIXHNQ-INIZCTEOSA-N |
| XLogP | 4.06 |
| TPSA | 71.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|