C18H17NO3 — CID 121105783
[3-(hydroxymethyl)azetidin-1-yl]-(9H-xanthen-9-yl)methanone (PubChem CID 121105783) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is [3-(hydroxymethyl)azetidin-1-yl]-(9H-xanthen-9-yl)methanone.
| Compound Name | [3-(hydroxymethyl)azetidin-1-yl]-(9H-xanthen-9-yl)methanone |
|---|---|
| PubChem CID | 121105783 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | [3-(hydroxymethyl)azetidin-1-yl]-(9H-xanthen-9-yl)methanone |
| SMILES | O=C(C1c2ccccc2Oc2ccccc21)N1CC(CO)C1 |
| InChI | InChI=1S/C18H17NO3/c20-11-12-9-19(10-12)18(21)17-13-5-1-3-7-15(13)22-16-8-4-2-6-14(16)17/h1-8,12,17,20H,9-11H2 |
| InChIKey | QUBNRGAGOZPIGS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |