C28H31N2O2+ — CID 25103491
dimethyl-(3-phenylpropyl)-[1-(9H-xanthene-9-carbonyl)azetidin-3-yl]azanium (PubChem CID 25103491) has the molecular formula C28H31N2O2+ and a molecular weight of 427.57 g/mol. Its IUPAC name is dimethyl-(3-phenylpropyl)-[1-(9H-xanthene-9-carbonyl)azetidin-3-yl]azanium.
| Compound Name | dimethyl-(3-phenylpropyl)-[1-(9H-xanthene-9-carbonyl)azetidin-3-yl]azanium |
|---|---|
| PubChem CID | 25103491 |
| Molecular Formula | C28H31N2O2+ |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | dimethyl-(3-phenylpropyl)-[1-(9H-xanthene-9-carbonyl)azetidin-3-yl]azanium |
| SMILES | C[N+](C)(CCCc1ccccc1)C1CN(C(=O)C2c3ccccc3Oc3ccccc32)C1 |
| InChI | InChI=1S/C28H31N2O2/c1-30(2,18-10-13-21-11-4-3-5-12-21)22-19-29(20-22)28(31)27-23-14-6-8-16-25(23)32-26-17-9-7-15-24(26)27/h3-9,11-12,14-17,22,27H,10,13,18-20H2,1-2H3/q+1 |
| InChIKey | PHADGSVCYPXJSU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|