C20H23N2O3P — CID 159270901
(3-phosphanyl-3-azabicyclo[3.1.0]hexan-6-yl)methanamine;9H-xanthene-9-carboxylic acid (PubChem CID 159270901) has the molecular formula C20H23N2O3P and a molecular weight of 370.39 g/mol. Its IUPAC name is (3-phosphanyl-3-azabicyclo[3.1.0]hexan-6-yl)methanamine;9H-xanthene-9-carboxylic acid.
| Compound Name | (3-phosphanyl-3-azabicyclo[3.1.0]hexan-6-yl)methanamine;9H-xanthene-9-carboxylic acid |
|---|---|
| PubChem CID | 159270901 |
| Molecular Formula | C20H23N2O3P |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (3-phosphanyl-3-azabicyclo[3.1.0]hexan-6-yl)methanamine;9H-xanthene-9-carboxylic acid |
| SMILES | NCC1C2CN(P)CC12.O=C(O)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C14H10O3.C6H13N2P/c15-14(16)13-9-5-1-3-7-11(9)17-12-8-4-2-6-10(12)13;7-1-4-5-2-8(9)3-6(4)5/h1-8,13H,(H,15,16);4-6H,1-3,7,9H2 |
| InChIKey | KXRWNNXAWREJAP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|