C23H33BrNO4+ — CID 174851967
2-hydroxyethyl-methyl-di(propan-2-yl)azanium;9H-xanthene-9-carboxylic acid;hydrobromide (PubChem CID 174851967) has the molecular formula C23H33BrNO4+ and a molecular weight of 467.42 g/mol. Its IUPAC name is 2-hydroxyethyl-methyl-di(propan-2-yl)azanium;9H-xanthene-9-carboxylic acid;hydrobromide.
| Compound Name | 2-hydroxyethyl-methyl-di(propan-2-yl)azanium;9H-xanthene-9-carboxylic acid;hydrobromide |
|---|---|
| PubChem CID | 174851967 |
| Molecular Formula | C23H33BrNO4+ |
| Molecular Weight | 467.42 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-hydroxyethyl-methyl-di(propan-2-yl)azanium;9H-xanthene-9-carboxylic acid;hydrobromide |
| SMILES | Br.CC(C)[N+](C)(CCO)C(C)C.O=C(O)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C14H10O3.C9H22NO.BrH/c15-14(16)13-9-5-1-3-7-11(9)17-12-8-4-2-6-10(12)13;1-8(2)10(5,6-7-11)9(3)4;/h1-8,13H,(H,15,16);8-9,11H,6-7H2,1-5H3;1H/q;+1; |
| InChIKey | VPRGAMQGLQQBSS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|