C16H14O3 — CID 139807013
2,3-dimethyl-9H-xanthene-9-carboxylic acid (PubChem CID 139807013) has the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. Its IUPAC name is 2,3-dimethyl-9H-xanthene-9-carboxylic acid.
| Compound Name | 2,3-dimethyl-9H-xanthene-9-carboxylic acid |
|---|---|
| PubChem CID | 139807013 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2,3-dimethyl-9H-xanthene-9-carboxylic acid |
| SMILES | Cc1cc2c(cc1C)C(C(=O)O)c1ccccc1O2 |
| InChI | InChI=1S/C16H14O3/c1-9-7-12-14(8-10(9)2)19-13-6-4-3-5-11(13)15(12)16(17)18/h3-8,15H,1-2H3,(H,17,18) |
| InChIKey | BMDCHYRDZKYESQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |