C18H14O7 — CID 23283091
2,7-bis(methoxycarbonyl)-9H-xanthene-9-carboxylic acid (PubChem CID 23283091) has the molecular formula C18H14O7 and a molecular weight of 342.30 g/mol. Its IUPAC name is 2,7-bis(methoxycarbonyl)-9H-xanthene-9-carboxylic acid.
| Compound Name | 2,7-bis(methoxycarbonyl)-9H-xanthene-9-carboxylic acid |
|---|---|
| PubChem CID | 23283091 |
| Molecular Formula | C18H14O7 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 2,7-bis(methoxycarbonyl)-9H-xanthene-9-carboxylic acid |
| SMILES | COC(=O)c1ccc2c(c1)C(C(=O)O)c1cc(C(=O)OC)ccc1O2 |
| InChI | InChI=1S/C18H14O7/c1-23-17(21)9-3-5-13-11(7-9)15(16(19)20)12-8-10(18(22)24-2)4-6-14(12)25-13/h3-8,15H,1-2H3,(H,19,20) |
| InChIKey | BDOCARQVPACKLT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |