C33H43IN2O6 — CID 23282962
dimethyl 9-[[1-(cyclooctylmethyl)-1-methylpiperidin-1-ium-4-yl]carbamoyl]-9H-xanthene-2,7-dicarboxylate iodide (PubChem CID 23282962) has the molecular formula C33H43IN2O6 and a molecular weight of 690.62 g/mol. Its IUPAC name is dimethyl 9-[[1-(cyclooctylmethyl)-1-methylpiperidin-1-ium-4-yl]carbamoyl]-9H-xanthene-2,7-dicarboxylate iodide.
| Compound Name | dimethyl 9-[[1-(cyclooctylmethyl)-1-methylpiperidin-1-ium-4-yl]carbamoyl]-9H-xanthene-2,7-dicarboxylate iodide |
|---|---|
| PubChem CID | 23282962 |
| Molecular Formula | C33H43IN2O6 |
| Molecular Weight | 690.62 g/mol |
| Exact Mass | 690.22 |
| IUPAC Name | dimethyl 9-[[1-(cyclooctylmethyl)-1-methylpiperidin-1-ium-4-yl]carbamoyl]-9H-xanthene-2,7-dicarboxylate iodide |
| SMILES | COC(=O)c1ccc2c(c1)C(C(=O)NC1CC[N+](C)(CC3CCCCCCC3)CC1)c1cc(C(=O)OC)ccc1O2.[I-] |
| InChI | InChI=1S/C33H42N2O6.HI/c1-35(21-22-9-7-5-4-6-8-10-22)17-15-25(16-18-35)34-31(36)30-26-19-23(32(37)39-2)11-13-28(26)41-29-14-12-24(20-27(29)30)33(38)40-3;/h11-14,19-20,22,25,30H,4-10,15-18,21H2,1-3H3;1H |
| InChIKey | GXTZUJRCJQMPRG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.62 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|