C29H39N2O2+ — CID 101004267
N-(1-cyclooctyl-1-ethylpiperidin-1-ium-4-yl)-9H-xanthene-9-carboxamide (PubChem CID 101004267) has the molecular formula C29H39N2O2+ and a molecular weight of 447.64 g/mol. Its IUPAC name is N-(1-cyclooctyl-1-ethylpiperidin-1-ium-4-yl)-9H-xanthene-9-carboxamide.
| Compound Name | N-(1-cyclooctyl-1-ethylpiperidin-1-ium-4-yl)-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 101004267 |
| Molecular Formula | C29H39N2O2+ |
| Molecular Weight | 447.64 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | N-(1-cyclooctyl-1-ethylpiperidin-1-ium-4-yl)-9H-xanthene-9-carboxamide |
| SMILES | CC[N+]1(C2CCCCCCC2)CCC(NC(=O)C2c3ccccc3Oc3ccccc32)CC1 |
| InChI | InChI=1S/C29H38N2O2/c1-2-31(23-12-6-4-3-5-7-13-23)20-18-22(19-21-31)30-29(32)28-24-14-8-10-16-26(24)33-27-17-11-9-15-25(27)28/h8-11,14-17,22-23,28H,2-7,12-13,18-21H2,1H3/p+1 |
| InChIKey | ZYYFFCHDQKJVIX-UHFFFAOYSA-O |
| XLogP | 6.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.64 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|