C30H40N2O3 — CID 57244164
N-[1-(3-oxoundecyl)piperidin-4-yl]-9H-xanthene-9-carboxamide (PubChem CID 57244164) has the molecular formula C30H40N2O3 and a molecular weight of 476.66 g/mol. Its IUPAC name is N-[1-(3-oxoundecyl)piperidin-4-yl]-9H-xanthene-9-carboxamide.
| Compound Name | N-[1-(3-oxoundecyl)piperidin-4-yl]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 57244164 |
| Molecular Formula | C30H40N2O3 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | N-[1-(3-oxoundecyl)piperidin-4-yl]-9H-xanthene-9-carboxamide |
| SMILES | CCCCCCCCC(=O)CCN1CCC(NC(=O)C2c3ccccc3Oc3ccccc32)CC1 |
| InChI | InChI=1S/C30H40N2O3/c1-2-3-4-5-6-7-12-24(33)19-22-32-20-17-23(18-21-32)31-30(34)29-25-13-8-10-15-27(25)35-28-16-11-9-14-26(28)29/h8-11,13-16,23,29H,2-7,12,17-22H2,1H3,(H,31,34) |
| InChIKey | WKZOEERYLNNSDG-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|