C28H37N2O2+ — CID 101004268
N-(1-cyclooctyl-1-methylpiperidin-1-ium-4-yl)-9H-xanthene-9-carboxamide (PubChem CID 101004268) has the molecular formula C28H37N2O2+ and a molecular weight of 433.62 g/mol. Its IUPAC name is N-(1-cyclooctyl-1-methylpiperidin-1-ium-4-yl)-9H-xanthene-9-carboxamide.
| Compound Name | N-(1-cyclooctyl-1-methylpiperidin-1-ium-4-yl)-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 101004268 |
| Molecular Formula | C28H37N2O2+ |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | N-(1-cyclooctyl-1-methylpiperidin-1-ium-4-yl)-9H-xanthene-9-carboxamide |
| SMILES | C[N+]1(C2CCCCCCC2)CCC(NC(=O)C2c3ccccc3Oc3ccccc32)CC1 |
| InChI | InChI=1S/C28H36N2O2/c1-30(22-11-5-3-2-4-6-12-22)19-17-21(18-20-30)29-28(31)27-23-13-7-9-15-25(23)32-26-16-10-8-14-24(26)27/h7-10,13-16,21-22,27H,2-6,11-12,17-20H2,1H3/p+1 |
| InChIKey | DHZVGYYAHSBOMI-UHFFFAOYSA-O |
| XLogP | 5.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|