C26H26N2O4S — CID 2228289
N-[4-(cyclohexylsulfamoyl)phenyl]-9H-xanthene-9-carboxamide (PubChem CID 2228289) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is N-[4-(cyclohexylsulfamoyl)phenyl]-9H-xanthene-9-carboxamide.
| Compound Name | N-[4-(cyclohexylsulfamoyl)phenyl]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 2228289 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | N-[4-(cyclohexylsulfamoyl)phenyl]-9H-xanthene-9-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NC2CCCCC2)cc1)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C26H26N2O4S/c29-26(25-21-10-4-6-12-23(21)32-24-13-7-5-11-22(24)25)27-18-14-16-20(17-15-18)33(30,31)28-19-8-2-1-3-9-19/h4-7,10-17,19,25,28H,1-3,8-9H2,(H,27,29) |
| InChIKey | WOHWNPMCJCOJGT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |