C15H20N2O3S — CID 67121777
N-[4-(cyclohexylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 67121777) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is N-[4-(cyclohexylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | N-[4-(cyclohexylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 67121777 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-[4-(cyclohexylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(S(=O)(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C15H20N2O3S/c1-2-15(18)16-12-8-10-14(11-9-12)21(19,20)17-13-6-4-3-5-7-13/h2,8-11,13,17H,1,3-7H2,(H,16,18) |
| InChIKey | HHDINNWKAMBXSZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|