C14H18Cl2N2O3S — CID 2228727
2,2-dichloro-N-[4-(cyclohexylsulfamoyl)phenyl]acetamide (PubChem CID 2228727) has the molecular formula C14H18Cl2N2O3S and a molecular weight of 365.28 g/mol. Its IUPAC name is 2,2-dichloro-N-[4-(cyclohexylsulfamoyl)phenyl]acetamide.
| Compound Name | 2,2-dichloro-N-[4-(cyclohexylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 2228727 |
| Molecular Formula | C14H18Cl2N2O3S |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 2,2-dichloro-N-[4-(cyclohexylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NC2CCCCC2)cc1)C(Cl)Cl |
| InChI | InChI=1S/C14H18Cl2N2O3S/c15-13(16)14(19)17-10-6-8-12(9-7-10)22(20,21)18-11-4-2-1-3-5-11/h6-9,11,13,18H,1-5H2,(H,17,19) |
| InChIKey | NLJBZABDYVBFSS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|