C22H27N3O5S2 — CID 19258102
N-[4-(cyclohexylsulfamoyl)phenyl]-4-(prop-2-enylsulfamoyl)benzamide (PubChem CID 19258102) has the molecular formula C22H27N3O5S2 and a molecular weight of 477.61 g/mol. Its IUPAC name is N-[4-(cyclohexylsulfamoyl)phenyl]-4-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | N-[4-(cyclohexylsulfamoyl)phenyl]-4-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 19258102 |
| Molecular Formula | C22H27N3O5S2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | N-[4-(cyclohexylsulfamoyl)phenyl]-4-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)Nc2ccc(S(=O)(=O)NC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C22H27N3O5S2/c1-2-16-23-31(27,28)20-12-8-17(9-13-20)22(26)24-18-10-14-21(15-11-18)32(29,30)25-19-6-4-3-5-7-19/h2,8-15,19,23,25H,1,3-7,16H2,(H,24,26) |
| InChIKey | JEFITCFNKSNTNN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|