C21H19N3O2S — CID 121144632
N-[1-(1,3-thiazol-2-yl)pyrrolidin-3-yl]-9H-xanthene-9-carboxamide (PubChem CID 121144632) has the molecular formula C21H19N3O2S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-[1-(1,3-thiazol-2-yl)pyrrolidin-3-yl]-9H-xanthene-9-carboxamide.
| Compound Name | N-[1-(1,3-thiazol-2-yl)pyrrolidin-3-yl]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 121144632 |
| Molecular Formula | C21H19N3O2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-[1-(1,3-thiazol-2-yl)pyrrolidin-3-yl]-9H-xanthene-9-carboxamide |
| SMILES | O=C(NC1CCN(c2nccs2)C1)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C21H19N3O2S/c25-20(23-14-9-11-24(13-14)21-22-10-12-27-21)19-15-5-1-3-7-17(15)26-18-8-4-2-6-16(18)19/h1-8,10,12,14,19H,9,11,13H2,(H,23,25) |
| InChIKey | KVSWLPHNEFPZIM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |