C20H19N3O2S — CID 121144744
2-phenoxy-N-[1-(1,3-thiazol-2-yl)pyrrolidin-3-yl]benzamide (PubChem CID 121144744) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is 2-phenoxy-N-[1-(1,3-thiazol-2-yl)pyrrolidin-3-yl]benzamide.
| Compound Name | 2-phenoxy-N-[1-(1,3-thiazol-2-yl)pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 121144744 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2-phenoxy-N-[1-(1,3-thiazol-2-yl)pyrrolidin-3-yl]benzamide |
| SMILES | O=C(NC1CCN(c2nccs2)C1)c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C20H19N3O2S/c24-19(22-15-10-12-23(14-15)20-21-11-13-26-20)17-8-4-5-9-18(17)25-16-6-2-1-3-7-16/h1-9,11,13,15H,10,12,14H2,(H,22,24) |
| InChIKey | QLVJSEFJJMZRFZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |