C11H18N4OS — CID 121144831
1-propyl-3-[1-(1,3-thiazol-2-yl)pyrrolidin-3-yl]urea (PubChem CID 121144831) has the molecular formula C11H18N4OS and a molecular weight of 254.36 g/mol. Its IUPAC name is 1-propyl-3-[1-(1,3-thiazol-2-yl)pyrrolidin-3-yl]urea.
| Compound Name | 1-propyl-3-[1-(1,3-thiazol-2-yl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 121144831 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 1-propyl-3-[1-(1,3-thiazol-2-yl)pyrrolidin-3-yl]urea |
| SMILES | CCCNC(=O)NC1CCN(c2nccs2)C1 |
| InChI | InChI=1S/C11H18N4OS/c1-2-4-12-10(16)14-9-3-6-15(8-9)11-13-5-7-17-11/h5,7,9H,2-4,6,8H2,1H3,(H2,12,14,16) |
| InChIKey | KPIQFBDNGZRLTO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |