C14H14ClN3OS — CID 121144583
4-chloro-N-[1-(1,3-thiazol-2-yl)pyrrolidin-3-yl]benzamide (PubChem CID 121144583) has the molecular formula C14H14ClN3OS and a molecular weight of 307.81 g/mol. Its IUPAC name is 4-chloro-N-[1-(1,3-thiazol-2-yl)pyrrolidin-3-yl]benzamide.
| Compound Name | 4-chloro-N-[1-(1,3-thiazol-2-yl)pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 121144583 |
| Molecular Formula | C14H14ClN3OS |
| Molecular Weight | 307.81 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 4-chloro-N-[1-(1,3-thiazol-2-yl)pyrrolidin-3-yl]benzamide |
| SMILES | O=C(NC1CCN(c2nccs2)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H14ClN3OS/c15-11-3-1-10(2-4-11)13(19)17-12-5-7-18(9-12)14-16-6-8-20-14/h1-4,6,8,12H,5,7,9H2,(H,17,19) |
| InChIKey | MAAZGMUWTDEICT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.81 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |