C14H16N4OS — CID 99875460
1-phenyl-3-[(3R)-1-(1,3-thiazol-2-yl)pyrrolidin-3-yl]urea (PubChem CID 99875460) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is 1-phenyl-3-[(3R)-1-(1,3-thiazol-2-yl)pyrrolidin-3-yl]urea.
| Compound Name | 1-phenyl-3-[(3R)-1-(1,3-thiazol-2-yl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 99875460 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 1-phenyl-3-[(3R)-1-(1,3-thiazol-2-yl)pyrrolidin-3-yl]urea |
| SMILES | O=C(Nc1ccccc1)N[C@@H]1CCN(c2nccs2)C1 |
| InChI | InChI=1S/C14H16N4OS/c19-13(16-11-4-2-1-3-5-11)17-12-6-8-18(10-12)14-15-7-9-20-14/h1-5,7,9,12H,6,8,10H2,(H2,16,17,19)/t12-/m1/s1 |
| InChIKey | IHKGMBKFDXUVAZ-GFCCVEGCSA-N |
| XLogP | 2.54 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |