C16H17ClN4O — CID 90621421
1-(4-chlorophenyl)-3-(1-pyridin-2-ylpyrrolidin-3-yl)urea (PubChem CID 90621421) has the molecular formula C16H17ClN4O and a molecular weight of 316.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(1-pyridin-2-ylpyrrolidin-3-yl)urea.
| Compound Name | 1-(4-chlorophenyl)-3-(1-pyridin-2-ylpyrrolidin-3-yl)urea |
|---|---|
| PubChem CID | 90621421 |
| Molecular Formula | C16H17ClN4O |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(1-pyridin-2-ylpyrrolidin-3-yl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)NC1CCN(c2ccccn2)C1 |
| InChI | InChI=1S/C16H17ClN4O/c17-12-4-6-13(7-5-12)19-16(22)20-14-8-10-21(11-14)15-3-1-2-9-18-15/h1-7,9,14H,8,10-11H2,(H2,19,20,22) |
| InChIKey | FOADFUYNKOTBGM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |