C16H16F2N4O — CID 97241132
1-(2,3-difluorophenyl)-3-[(3R)-1-pyridin-2-ylpyrrolidin-3-yl]urea (PubChem CID 97241132) has the molecular formula C16H16F2N4O and a molecular weight of 318.33 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-3-[(3R)-1-pyridin-2-ylpyrrolidin-3-yl]urea.
| Compound Name | 1-(2,3-difluorophenyl)-3-[(3R)-1-pyridin-2-ylpyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 97241132 |
| Molecular Formula | C16H16F2N4O |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 1-(2,3-difluorophenyl)-3-[(3R)-1-pyridin-2-ylpyrrolidin-3-yl]urea |
| SMILES | O=C(Nc1cccc(F)c1F)N[C@@H]1CCN(c2ccccn2)C1 |
| InChI | InChI=1S/C16H16F2N4O/c17-12-4-3-5-13(15(12)18)21-16(23)20-11-7-9-22(10-11)14-6-1-2-8-19-14/h1-6,8,11H,7,9-10H2,(H2,20,21,23)/t11-/m1/s1 |
| InChIKey | WDUWHZAAOJPFIO-LLVKDONJSA-N |
| XLogP | 2.76 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |