C16H18FN5O — CID 67293554
1-[1-(5-amino-2-pyridinyl)pyrrolidin-3-yl]-3-(2-fluorophenyl)urea (PubChem CID 67293554) has the molecular formula C16H18FN5O and a molecular weight of 315.35 g/mol. Its IUPAC name is 1-[1-(5-amino-2-pyridinyl)pyrrolidin-3-yl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[1-(5-amino-2-pyridinyl)pyrrolidin-3-yl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 67293554 |
| Molecular Formula | C16H18FN5O |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 1-[1-(5-amino-2-pyridinyl)pyrrolidin-3-yl]-3-(2-fluorophenyl)urea |
| SMILES | Nc1ccc(N2CCC(NC(=O)Nc3ccccc3F)C2)nc1 |
| InChI | InChI=1S/C16H18FN5O/c17-13-3-1-2-4-14(13)21-16(23)20-12-7-8-22(10-12)15-6-5-11(18)9-19-15/h1-6,9,12H,7-8,10,18H2,(H2,20,21,23) |
| InChIKey | YYXWUQIVFDEFLA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |