C16H16FN5O2 — CID 67391269
4-(5-amino-2-pyridinyl)-N-(2-fluorophenyl)-2-oxopiperazine-1-carboxamide (PubChem CID 67391269) has the molecular formula C16H16FN5O2 and a molecular weight of 329.34 g/mol. Its IUPAC name is 4-(5-amino-2-pyridinyl)-N-(2-fluorophenyl)-2-oxopiperazine-1-carboxamide.
| Compound Name | 4-(5-amino-2-pyridinyl)-N-(2-fluorophenyl)-2-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 67391269 |
| Molecular Formula | C16H16FN5O2 |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 4-(5-amino-2-pyridinyl)-N-(2-fluorophenyl)-2-oxopiperazine-1-carboxamide |
| SMILES | Nc1ccc(N2CCN(C(=O)Nc3ccccc3F)C(=O)C2)nc1 |
| InChI | InChI=1S/C16H16FN5O2/c17-12-3-1-2-4-13(12)20-16(24)22-8-7-21(10-15(22)23)14-6-5-11(18)9-19-14/h1-6,9H,7-8,10,18H2,(H,20,24) |
| InChIKey | XZQQMSVPJVOTST-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |