C15H13FN2O — CID 6468631
N-(2-fluorophenyl)-2,3-dihydroindole-1-carboxamide (PubChem CID 6468631) has the molecular formula C15H13FN2O and a molecular weight of 256.28 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-(2-fluorophenyl)-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 6468631 |
| Molecular Formula | C15H13FN2O |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-(2-fluorophenyl)-2,3-dihydroindole-1-carboxamide |
| SMILES | O=C(Nc1ccccc1F)N1CCc2ccccc21 |
| InChI | InChI=1S/C15H13FN2O/c16-12-6-2-3-7-13(12)17-15(19)18-10-9-11-5-1-4-8-14(11)18/h1-8H,9-10H2,(H,17,19) |
| InChIKey | KGMKEDFLALOHCW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |