C15H14N2OS — CID 108886503
N-(2-sulfanylphenyl)-2,3-dihydroindole-1-carboxamide (PubChem CID 108886503) has the molecular formula C15H14N2OS and a molecular weight of 270.36 g/mol. Its IUPAC name is N-(2-sulfanylphenyl)-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-(2-sulfanylphenyl)-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 108886503 |
| Molecular Formula | C15H14N2OS |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N-(2-sulfanylphenyl)-2,3-dihydroindole-1-carboxamide |
| SMILES | O=C(Nc1ccccc1S)N1CCc2ccccc21 |
| InChI | InChI=1S/C15H14N2OS/c18-15(16-12-6-2-4-8-14(12)19)17-10-9-11-5-1-3-7-13(11)17/h1-8,19H,9-10H2,(H,16,18) |
| InChIKey | KXPWAQDAUXVLQD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|