C19H22N2O — CID 108991191
N-(2,6-diethylphenyl)-2,3-dihydroindole-1-carboxamide (PubChem CID 108991191) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-(2,6-diethylphenyl)-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 108991191 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-(2,6-diethylphenyl)-2,3-dihydroindole-1-carboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C19H22N2O/c1-3-14-9-7-10-15(4-2)18(14)20-19(22)21-13-12-16-8-5-6-11-17(16)21/h5-11H,3-4,12-13H2,1-2H3,(H,20,22) |
| InChIKey | ATPHDRPUVFUZNB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |