C15H13BN2O — CID 144672697
CID 144672697 (PubChem CID 144672697) has the molecular formula C15H13BN2O and a molecular weight of 248.09 g/mol.
| Compound Name | CID 144672697 |
|---|---|
| PubChem CID | 144672697 |
| Molecular Formula | C15H13BN2O |
| Molecular Weight | 248.09 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(NC(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C15H13BN2O/c16-12-5-7-13(8-6-12)17-15(19)18-10-9-11-3-1-2-4-14(11)18/h1-8H,9-10H2,(H,17,19) |
| InChIKey | AMHHICULMGCIQR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.09 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|