C24H19N3O2 — CID 90283420
N-[4-(1-oxo-2H-isoquinolin-4-yl)phenyl]-2,3-dihydroindole-1-carboxamide (PubChem CID 90283420) has the molecular formula C24H19N3O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is N-[4-(1-oxo-2H-isoquinolin-4-yl)phenyl]-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-[4-(1-oxo-2H-isoquinolin-4-yl)phenyl]-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 90283420 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N-[4-(1-oxo-2H-isoquinolin-4-yl)phenyl]-2,3-dihydroindole-1-carboxamide |
| SMILES | O=C(Nc1ccc(-c2c[nH]c(=O)c3ccccc23)cc1)N1CCc2ccccc21 |
| InChI | InChI=1S/C24H19N3O2/c28-23-20-7-3-2-6-19(20)21(15-25-23)16-9-11-18(12-10-16)26-24(29)27-14-13-17-5-1-4-8-22(17)27/h1-12,15H,13-14H2,(H,25,28)(H,26,29) |
| InChIKey | FIICCIFGIGHGSR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |