C18H20N2O2 — CID 69223923
N-(4-hydroxyphenyl)-3,4,5,6-tetrahydro-2H-1-benzazocine-1-carboxamide (PubChem CID 69223923) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-3,4,5,6-tetrahydro-2H-1-benzazocine-1-carboxamide.
| Compound Name | N-(4-hydroxyphenyl)-3,4,5,6-tetrahydro-2H-1-benzazocine-1-carboxamide |
|---|---|
| PubChem CID | 69223923 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N-(4-hydroxyphenyl)-3,4,5,6-tetrahydro-2H-1-benzazocine-1-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1)N1CCCCCc2ccccc21 |
| InChI | InChI=1S/C18H20N2O2/c21-16-11-9-15(10-12-16)19-18(22)20-13-5-1-2-6-14-7-3-4-8-17(14)20/h3-4,7-12,21H,1-2,5-6,13H2,(H,19,22) |
| InChIKey | DJAYQKKUNIESNL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|