C17H18N2O — CID 6470011
N-(3,4-dimethylphenyl)-2,3-dihydroindole-1-carboxamide (PubChem CID 6470011) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2,3-dihydroindole-1-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 6470011 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2,3-dihydroindole-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCc3ccccc32)cc1C |
| InChI | InChI=1S/C17H18N2O/c1-12-7-8-15(11-13(12)2)18-17(20)19-10-9-14-5-3-4-6-16(14)19/h3-8,11H,9-10H2,1-2H3,(H,18,20) |
| InChIKey | MLDSGYHSDRVLMW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |