C23H22N2O3S — CID 43006039
4-(2,3-dihydroindole-1-carbonyl)-N-(3,4-dimethylphenyl)benzenesulfonamide (PubChem CID 43006039) has the molecular formula C23H22N2O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is 4-(2,3-dihydroindole-1-carbonyl)-N-(3,4-dimethylphenyl)benzenesulfonamide.
| Compound Name | 4-(2,3-dihydroindole-1-carbonyl)-N-(3,4-dimethylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43006039 |
| Molecular Formula | C23H22N2O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 4-(2,3-dihydroindole-1-carbonyl)-N-(3,4-dimethylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C(=O)N3CCc4ccccc43)cc2)cc1C |
| InChI | InChI=1S/C23H22N2O3S/c1-16-7-10-20(15-17(16)2)24-29(27,28)21-11-8-19(9-12-21)23(26)25-14-13-18-5-3-4-6-22(18)25/h3-12,15,24H,13-14H2,1-2H3 |
| InChIKey | GRWCHNHSHHZYDZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |