C25H26N4O5S — CID 27825919
N-(3,4-dimethylphenyl)-4-[4-(2-nitrophenyl)piperazine-1-carbonyl]benzenesulfonamide (PubChem CID 27825919) has the molecular formula C25H26N4O5S and a molecular weight of 494.57 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-4-[4-(2-nitrophenyl)piperazine-1-carbonyl]benzenesulfonamide.
| Compound Name | N-(3,4-dimethylphenyl)-4-[4-(2-nitrophenyl)piperazine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 27825919 |
| Molecular Formula | C25H26N4O5S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | N-(3,4-dimethylphenyl)-4-[4-(2-nitrophenyl)piperazine-1-carbonyl]benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C(=O)N3CCN(c4ccccc4[N+](=O)[O-])CC3)cc2)cc1C |
| InChI | InChI=1S/C25H26N4O5S/c1-18-7-10-21(17-19(18)2)26-35(33,34)22-11-8-20(9-12-22)25(30)28-15-13-27(14-16-28)23-5-3-4-6-24(23)29(31)32/h3-12,17,26H,13-16H2,1-2H3 |
| InChIKey | BKZKNUITLZVWIE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|