C24H23FN4O5S — CID 26556430
N-(4-fluorophenyl)-4-methyl-3-[4-(2-nitrophenyl)piperazine-1-carbonyl]benzenesulfonamide (PubChem CID 26556430) has the molecular formula C24H23FN4O5S and a molecular weight of 498.54 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-methyl-3-[4-(2-nitrophenyl)piperazine-1-carbonyl]benzenesulfonamide.
| Compound Name | N-(4-fluorophenyl)-4-methyl-3-[4-(2-nitrophenyl)piperazine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 26556430 |
| Molecular Formula | C24H23FN4O5S |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | N-(4-fluorophenyl)-4-methyl-3-[4-(2-nitrophenyl)piperazine-1-carbonyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1C(=O)N1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C24H23FN4O5S/c1-17-6-11-20(35(33,34)26-19-9-7-18(25)8-10-19)16-21(17)24(30)28-14-12-27(13-15-28)22-4-2-3-5-23(22)29(31)32/h2-11,16,26H,12-15H2,1H3 |
| InChIKey | QWMYFCIQCXLILX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|