C27H31N3O3S — CID 35800211
4-(4-benzyl-1,4-diazepane-1-carbonyl)-N-(3,4-dimethylphenyl)benzenesulfonamide (PubChem CID 35800211) has the molecular formula C27H31N3O3S and a molecular weight of 477.63 g/mol. Its IUPAC name is 4-(4-benzyl-1,4-diazepane-1-carbonyl)-N-(3,4-dimethylphenyl)benzenesulfonamide.
| Compound Name | 4-(4-benzyl-1,4-diazepane-1-carbonyl)-N-(3,4-dimethylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 35800211 |
| Molecular Formula | C27H31N3O3S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 4-(4-benzyl-1,4-diazepane-1-carbonyl)-N-(3,4-dimethylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C(=O)N3CCCN(Cc4ccccc4)CC3)cc2)cc1C |
| InChI | InChI=1S/C27H31N3O3S/c1-21-9-12-25(19-22(21)2)28-34(32,33)26-13-10-24(11-14-26)27(31)30-16-6-15-29(17-18-30)20-23-7-4-3-5-8-23/h3-5,7-14,19,28H,6,15-18,20H2,1-2H3 |
| InChIKey | PMGSYMNOSJDQHZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |