C35H36N4O5S — CID 163830133
[3-[[4-[4-[[2-(benzylideneamino)-3-methylphenyl]sulfonylamino]benzoyl]-1,4-diazepan-1-yl]methyl]phenyl] acetate (PubChem CID 163830133) has the molecular formula C35H36N4O5S and a molecular weight of 624.76 g/mol. Its IUPAC name is [3-[[4-[4-[[2-(benzylideneamino)-3-methylphenyl]sulfonylamino]benzoyl]-1,4-diazepan-1-yl]methyl]phenyl] acetate.
| Compound Name | [3-[[4-[4-[[2-(benzylideneamino)-3-methylphenyl]sulfonylamino]benzoyl]-1,4-diazepan-1-yl]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 163830133 |
| Molecular Formula | C35H36N4O5S |
| Molecular Weight | 624.76 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | [3-[[4-[4-[[2-(benzylideneamino)-3-methylphenyl]sulfonylamino]benzoyl]-1,4-diazepan-1-yl]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(CN2CCCN(C(=O)c3ccc(NS(=O)(=O)c4cccc(C)c4/N=C/c4ccccc4)cc3)CC2)c1 |
| InChI | InChI=1S/C35H36N4O5S/c1-26-9-6-14-33(34(26)36-24-28-10-4-3-5-11-28)45(42,43)37-31-17-15-30(16-18-31)35(41)39-20-8-19-38(21-22-39)25-29-12-7-13-32(23-29)44-27(2)40/h3-7,9-18,23-24,37H,8,19-22,25H2,1-2H3/b36-24+ |
| InChIKey | OCZBQHMYPKXERR-XBQJKBNESA-N |
| XLogP | 5.82 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.76 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|