C21H23N3O6S — CID 108533205
[3-[4-[4-(methanesulfonamido)benzoyl]piperazine-1-carbonyl]phenyl] acetate (PubChem CID 108533205) has the molecular formula C21H23N3O6S and a molecular weight of 445.50 g/mol. Its IUPAC name is [3-[4-[4-(methanesulfonamido)benzoyl]piperazine-1-carbonyl]phenyl] acetate.
| Compound Name | [3-[4-[4-(methanesulfonamido)benzoyl]piperazine-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 108533205 |
| Molecular Formula | C21H23N3O6S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | [3-[4-[4-(methanesulfonamido)benzoyl]piperazine-1-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)N2CCN(C(=O)c3ccc(NS(C)(=O)=O)cc3)CC2)c1 |
| InChI | InChI=1S/C21H23N3O6S/c1-15(25)30-19-5-3-4-17(14-19)21(27)24-12-10-23(11-13-24)20(26)16-6-8-18(9-7-16)22-31(2,28)29/h3-9,14,22H,10-13H2,1-2H3 |
| InChIKey | MVNGVPLLPOCHRE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|