C23H21N3O6S — CID 108927824
[3-[[3-[[4-(methanesulfonamido)benzoyl]amino]phenyl]carbamoyl]phenyl] acetate (PubChem CID 108927824) has the molecular formula C23H21N3O6S and a molecular weight of 467.50 g/mol. Its IUPAC name is [3-[[3-[[4-(methanesulfonamido)benzoyl]amino]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[3-[[4-(methanesulfonamido)benzoyl]amino]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108927824 |
| Molecular Formula | C23H21N3O6S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | [3-[[3-[[4-(methanesulfonamido)benzoyl]amino]phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)Nc2cccc(NC(=O)c3ccc(NS(C)(=O)=O)cc3)c2)c1 |
| InChI | InChI=1S/C23H21N3O6S/c1-15(27)32-21-8-3-5-17(13-21)23(29)25-20-7-4-6-19(14-20)24-22(28)16-9-11-18(12-10-16)26-33(2,30)31/h3-14,26H,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | BRYOVAOGOINOHC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|